1-(2-Benzo[1,3]dioxol-5-yl-acetyl)-3-methyl-urea Properties, Molecular Formula, Applications - WorldOfChemicals

1-(2-Benzo[1,3]dioxol-5-yl-acetyl)-3-methyl-urea Properties




Chemical Properties

IUPAC Name 2-(1,3-Benzodioxol-5-yl)-N-(methylcarbamoyl)acetamide
InChI 1S/C11H12N2O4/c1-12-11(15)13-10(14)5-7-2-3-8-9(4-7)17-6-16-8/h2-4H,5-6H2,1H3,(H2,12,13,14,15)
Molar Mass 236.22 g/mol
Molecular Formula C111S/C11H12N2O4/c1-12-11(15)13-10(14)5-7-2-3-8-9(4-7)17-6-16-8/h2-4H,5-6H2,1H3,(H2,12,13,14,15)H12N2O4