(2S,5S,8R)-2-Hydroxymethyl-5-methyl-3,6,15-trioxo-1,4,7triaza-cyclopentadecane-8-carboxylic acid msds| properties| cas no| molecular formula | WorldOfChemicals

(2S,5S,8R)-2-Hydroxymethyl-5-methyl-3,6,15-trioxo-1,4,7triaza-cyclopentadecane-8-carboxylic acid Properties

(2S,5S,8R)-2-Hydroxymethyl-5-methyl-3,6,15-trioxo-1,4,7triaza-cyclopentadecane-8-carboxylic acid

Description

 

Chemical Properties

IUPAC Name (2S,5S,8R)-2-(Hydroxymethyl)-5-methyl-3,6,15-trioxo-1,4,7-triazacyclopentadecane-8-carboxylic acid
InChI InChI=1S/C15H25N3O6/c1-9-13(21)18-10(15(23)24)6-4-2-3-5-7-12(20)17-11(8-19)14(22)16-9/h9-11,19H,2-8H2,1H3,(H,16,22)(H,17,20)(H,18,21)(H,23,24)/t9-,10+,11-/m0/s1
InChIKey OURNOUVWSSKCEH-AXFHLTTASA-N
Molar Mass 343.37 g/mol
Molecular Formula C15H25N3O6